C12H19ClN2 — CID 10421259
3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline (PubChem CID 10421259) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline.
| Compound Name | 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline |
|---|---|
| PubChem CID | 10421259 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline |
| SMILES | CNC(C)Cc1ccc(N(C)C)cc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-9(14-2)7-10-5-6-11(15(3)4)8-12(10)13/h5-6,8-9,14H,7H2,1-4H3 |
| InChIKey | VLAALKUIXKASHK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |