About 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline
3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline (PubChem CID 10421259) has the molecular formula C12H19ClN2
and a molecular weight of 226.75 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline.
Molecular Properties
| Compound Name | 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline |
| PubChem CID | 10421259 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline |
| SMILES | CNC(C)Cc1ccc(N(C)C)cc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-9(14-2)7-10-5-6-11(15(3)4)8-12(10)13/h5-6,8-9,14H,7H2,1-4H3 |
| InChIKey | VLAALKUIXKASHK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline?
The IUPAC name of 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline (CID 10421259) is 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline.
What is the SMILES notation for 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline?
The canonical SMILES for 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline is CNC(C)Cc1ccc(N(C)C)cc1Cl.
What is the InChIKey of 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline?
The InChIKey is VLAALKUIXKASHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN2/c1-9(14-2)7-10-5-6-11(15(3)4)8-12(10)13/h5-6,8-9,14H,7H2,1-4H3.
What are the key properties of 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline?
3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline has a molecular weight of 226.75 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-dimethyl-4-[2-(methylamino)propyl]aniline is sourced from PubChem (CID 10421259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).