C12H20N4O3 — CID 10423162
N-[(4S)-1-(2-amino-2-oxoethyl)-2-oxopiperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 10423162) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(4S)-1-(2-amino-2-oxoethyl)-2-oxopiperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4S)-1-(2-amino-2-oxoethyl)-2-oxopiperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10423162 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-[(4S)-1-(2-amino-2-oxoethyl)-2-oxopiperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CN1CC[C@H](NC(=O)C2CCCN2)CC1=O |
| InChI | InChI=1S/C12H20N4O3/c13-10(17)7-16-5-3-8(6-11(16)18)15-12(19)9-2-1-4-14-9/h8-9,14H,1-7H2,(H2,13,17)(H,15,19)/t8-,9?/m0/s1 |
| InChIKey | FAHKMLHZHXRLSZ-IENPIDJESA-N |
| XLogP | -1.67 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |