C17H30O3 — CID 10423922
(10S)-8-methyl-10-(oxan-2-yloxy)undec-1-en-6-one (PubChem CID 10423922) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (10S)-8-methyl-10-(oxan-2-yloxy)undec-1-en-6-one.
| Compound Name | (10S)-8-methyl-10-(oxan-2-yloxy)undec-1-en-6-one |
|---|---|
| PubChem CID | 10423922 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (10S)-8-methyl-10-(oxan-2-yloxy)undec-1-en-6-one |
| SMILES | C=CCCCC(=O)CC(C)C[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C17H30O3/c1-4-5-6-9-16(18)13-14(2)12-15(3)20-17-10-7-8-11-19-17/h4,14-15,17H,1,5-13H2,2-3H3/t14?,15-,17?/m0/s1 |
| InChIKey | DILGMOZDZXHKMX-CKDBGZEDSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|