C27H47FO3 — CID 163716044
4-fluoro-1-[(1R,8R)-2-methyl-8-(oxan-2-yloxy)-4-pentylcyclooct-4-en-1-yl]octan-3-one (PubChem CID 163716044) has the molecular formula C27H47FO3 and a molecular weight of 438.67 g/mol. Its IUPAC name is 4-fluoro-1-[(1R,8R)-2-methyl-8-(oxan-2-yloxy)-4-pentylcyclooct-4-en-1-yl]octan-3-one.
| Compound Name | 4-fluoro-1-[(1R,8R)-2-methyl-8-(oxan-2-yloxy)-4-pentylcyclooct-4-en-1-yl]octan-3-one |
|---|---|
| PubChem CID | 163716044 |
| Molecular Formula | C27H47FO3 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 4-fluoro-1-[(1R,8R)-2-methyl-8-(oxan-2-yloxy)-4-pentylcyclooct-4-en-1-yl]octan-3-one |
| SMILES | CCCCCC1=CCC[C@@H](OC2CCCCO2)[C@H](CCC(=O)C(F)CCCC)C(C)C1 |
| InChI | InChI=1S/C27H47FO3/c1-4-6-8-12-22-13-11-15-26(31-27-16-9-10-19-30-27)23(21(3)20-22)17-18-25(29)24(28)14-7-5-2/h13,21,23-24,26-27H,4-12,14-20H2,1-3H3/t21?,23-,24?,26-,27?/m1/s1 |
| InChIKey | KNKNIGOPOQLTJN-HJOSIUSASA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|