C15H26O3 — CID 10879663
(2R,5S,6R)-2,6-dimethyl-5-(oxan-2-yloxy)oct-7-enal (PubChem CID 10879663) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2R,5S,6R)-2,6-dimethyl-5-(oxan-2-yloxy)oct-7-enal.
| Compound Name | (2R,5S,6R)-2,6-dimethyl-5-(oxan-2-yloxy)oct-7-enal |
|---|---|
| PubChem CID | 10879663 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2R,5S,6R)-2,6-dimethyl-5-(oxan-2-yloxy)oct-7-enal |
| SMILES | C=C[C@@H](C)[C@H](CC[C@@H](C)C=O)OC1CCCCO1 |
| InChI | InChI=1S/C15H26O3/c1-4-13(3)14(9-8-12(2)11-16)18-15-7-5-6-10-17-15/h4,11-15H,1,5-10H2,2-3H3/t12-,13-,14+,15?/m1/s1 |
| InChIKey | LTYNSYILDHUUIK-JKXDFHQYSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|