C13H22O3 — CID 71534368
(2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propanal (PubChem CID 71534368) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propanal.
| Compound Name | (2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propanal |
|---|---|
| PubChem CID | 71534368 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propanal |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@@H]([C@H](C)C=O)[C@@H]1C |
| InChI | InChI=1S/C13H22O3/c1-6-7-11-10(3)12(9(2)8-14)16-13(4,5)15-11/h6,8-12H,1,7H2,2-5H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | VNCYTSALCKDOOO-WYUUTHIRSA-N |
| XLogP | 2.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|