C16H20O5 — CID 10424422
(4Z)-6,7-dimethoxy-4-pentylidene-1H-isochromene-5,8-dione (PubChem CID 10424422) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (4Z)-6,7-dimethoxy-4-pentylidene-1H-isochromene-5,8-dione.
| Compound Name | (4Z)-6,7-dimethoxy-4-pentylidene-1H-isochromene-5,8-dione |
|---|---|
| PubChem CID | 10424422 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (4Z)-6,7-dimethoxy-4-pentylidene-1H-isochromene-5,8-dione |
| SMILES | CCCC/C=C1\COCC2=C1C(=O)C(OC)=C(OC)C2=O |
| InChI | InChI=1S/C16H20O5/c1-4-5-6-7-10-8-21-9-11-12(10)14(18)16(20-3)15(19-2)13(11)17/h7H,4-6,8-9H2,1-3H3/b10-7+ |
| InChIKey | AQUXYDHFALXOSC-JXMROGBWSA-N |
| XLogP | 2.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|