C18H18O4 — CID 10424760
(4aR)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione (PubChem CID 10424760) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (4aR)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione.
| Compound Name | (4aR)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione |
|---|---|
| PubChem CID | 10424760 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (4aR)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione |
| SMILES | COc1ccc2c(c1)[C@]1(C)C=CC(=O)C(C)(C)C1C(=O)C2=O |
| InChI | InChI=1S/C18H18O4/c1-17(2)13(19)7-8-18(3)12-9-10(22-4)5-6-11(12)14(20)15(21)16(17)18/h5-9,16H,1-4H3/t16?,18-/m0/s1 |
| InChIKey | LRJJBDNWPKOLRQ-DAFXYXGESA-N |
| XLogP | 2.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|