C19H20O3 — CID 58862585
(4aR)-6-methoxy-1,1,4a-trimethyl-9-methylidene-10aH-phenanthrene-2,10-dione (PubChem CID 58862585) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (4aR)-6-methoxy-1,1,4a-trimethyl-9-methylidene-10aH-phenanthrene-2,10-dione.
| Compound Name | (4aR)-6-methoxy-1,1,4a-trimethyl-9-methylidene-10aH-phenanthrene-2,10-dione |
|---|---|
| PubChem CID | 58862585 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (4aR)-6-methoxy-1,1,4a-trimethyl-9-methylidene-10aH-phenanthrene-2,10-dione |
| SMILES | C=C1C(=O)C2C(C)(C)C(=O)C=C[C@@]2(C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C19H20O3/c1-11-13-7-6-12(22-5)10-14(13)19(4)9-8-15(20)18(2,3)17(19)16(11)21/h6-10,17H,1H2,2-5H3/t17?,19-/m0/s1 |
| InChIKey | SZVYMSCRCGBLSH-NNBQYGFHSA-N |
| XLogP | 3.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|