C19H17NOS — CID 10425345
(E)-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol (PubChem CID 10425345) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is (E)-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol.
| Compound Name | (E)-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 10425345 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (E)-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol |
| SMILES | OC(/C=C/c1ccccc1)Cc1cc(-c2ccccc2)sn1 |
| InChI | InChI=1S/C19H17NOS/c21-18(12-11-15-7-3-1-4-8-15)13-17-14-19(22-20-17)16-9-5-2-6-10-16/h1-12,14,18,21H,13H2/b12-11+ |
| InChIKey | AJEULUPKLJEKLK-VAWYXSNFSA-N |
| XLogP | 4.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |