C16H19NOS — CID 10016135
1-[(5-phenyl-1,2-thiazol-3-yl)methyl]cyclohexan-1-ol (PubChem CID 10016135) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-[(5-phenyl-1,2-thiazol-3-yl)methyl]cyclohexan-1-ol.
| Compound Name | 1-[(5-phenyl-1,2-thiazol-3-yl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10016135 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-[(5-phenyl-1,2-thiazol-3-yl)methyl]cyclohexan-1-ol |
| SMILES | OC1(Cc2cc(-c3ccccc3)sn2)CCCCC1 |
| InChI | InChI=1S/C16H19NOS/c18-16(9-5-2-6-10-16)12-14-11-15(19-17-14)13-7-3-1-4-8-13/h1,3-4,7-8,11,18H,2,5-6,9-10,12H2 |
| InChIKey | KWPZLHBUPHDNCO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |