C22H20N2OS2 — CID 11741257
2-methyl-1,3-bis(5-phenyl-1,2-thiazol-3-yl)propan-2-ol (PubChem CID 11741257) has the molecular formula C22H20N2OS2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-methyl-1,3-bis(5-phenyl-1,2-thiazol-3-yl)propan-2-ol.
| Compound Name | 2-methyl-1,3-bis(5-phenyl-1,2-thiazol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 11741257 |
| Molecular Formula | C22H20N2OS2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-methyl-1,3-bis(5-phenyl-1,2-thiazol-3-yl)propan-2-ol |
| SMILES | CC(O)(Cc1cc(-c2ccccc2)sn1)Cc1cc(-c2ccccc2)sn1 |
| InChI | InChI=1S/C22H20N2OS2/c1-22(25,14-18-12-20(26-23-18)16-8-4-2-5-9-16)15-19-13-21(27-24-19)17-10-6-3-7-11-17/h2-13,25H,14-15H2,1H3 |
| InChIKey | BEHKGHKCUYWORE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |