C17H15NOS — CID 10446470
1-phenyl-2-(5-phenyl-1,2-thiazol-3-yl)ethanol (PubChem CID 10446470) has the molecular formula C17H15NOS and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-phenyl-2-(5-phenyl-1,2-thiazol-3-yl)ethanol.
| Compound Name | 1-phenyl-2-(5-phenyl-1,2-thiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 10446470 |
| Molecular Formula | C17H15NOS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-phenyl-2-(5-phenyl-1,2-thiazol-3-yl)ethanol |
| SMILES | OC(Cc1cc(-c2ccccc2)sn1)c1ccccc1 |
| InChI | InChI=1S/C17H15NOS/c19-16(13-7-3-1-4-8-13)11-15-12-17(20-18-15)14-9-5-2-6-10-14/h1-10,12,16,19H,11H2 |
| InChIKey | VWSIDNPHPXCGDL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |