C20H19NOS — CID 10018993
(E)-2-methyl-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol (PubChem CID 10018993) has the molecular formula C20H19NOS and a molecular weight of 321.45 g/mol. Its IUPAC name is (E)-2-methyl-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol.
| Compound Name | (E)-2-methyl-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 10018993 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (E)-2-methyl-4-phenyl-1-(5-phenyl-1,2-thiazol-3-yl)but-3-en-2-ol |
| SMILES | CC(O)(/C=C/c1ccccc1)Cc1cc(-c2ccccc2)sn1 |
| InChI | InChI=1S/C20H19NOS/c1-20(22,13-12-16-8-4-2-5-9-16)15-18-14-19(23-21-18)17-10-6-3-7-11-17/h2-14,22H,15H2,1H3/b13-12+ |
| InChIKey | GJHNSYSDCJBSJF-OUKQBFOZSA-N |
| XLogP | 4.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |