C11H22N2O4S2 — CID 10425528
N'-[(2E)-3,7-dimethylocta-2,6-dienyl]methanedisulfonamide (PubChem CID 10425528) has the molecular formula C11H22N2O4S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N'-[(2E)-3,7-dimethylocta-2,6-dienyl]methanedisulfonamide.
| Compound Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]methanedisulfonamide |
|---|---|
| PubChem CID | 10425528 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]methanedisulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/CNS(=O)(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C11H22N2O4S2/c1-10(2)5-4-6-11(3)7-8-13-19(16,17)9-18(12,14)15/h5,7,13H,4,6,8-9H2,1-3H3,(H2,12,14,15)/b11-7+ |
| InChIKey | LKHFSTPTNUXQNR-YRNVUSSQSA-N |
| XLogP | 0.84 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|