C18H22O3S — CID 10426045
[(2S)-1-[(1R)-2-oxo-1-phenylsulfanylcyclohexyl]but-3-en-2-yl] acetate (PubChem CID 10426045) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is [(2S)-1-[(1R)-2-oxo-1-phenylsulfanylcyclohexyl]but-3-en-2-yl] acetate.
| Compound Name | [(2S)-1-[(1R)-2-oxo-1-phenylsulfanylcyclohexyl]but-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 10426045 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(2S)-1-[(1R)-2-oxo-1-phenylsulfanylcyclohexyl]but-3-en-2-yl] acetate |
| SMILES | C=C[C@H](C[C@]1(Sc2ccccc2)CCCCC1=O)OC(C)=O |
| InChI | InChI=1S/C18H22O3S/c1-3-15(21-14(2)19)13-18(12-8-7-11-17(18)20)22-16-9-5-4-6-10-16/h3-6,9-10,15H,1,7-8,11-13H2,2H3/t15-,18-/m1/s1 |
| InChIKey | KFLYJTGFNXRCAX-CRAIPNDOSA-N |
| XLogP | 4.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|