C21H38O3 — CID 10427278
(1S,2R,3R,5R)-3-[(Z)-2-(4-hydroxy-1-methylcyclohexyl)ethenyl]-5-(5-methylhexyl)cyclopentane-1,2-diol (PubChem CID 10427278) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[(Z)-2-(4-hydroxy-1-methylcyclohexyl)ethenyl]-5-(5-methylhexyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-[(Z)-2-(4-hydroxy-1-methylcyclohexyl)ethenyl]-5-(5-methylhexyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 10427278 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | (1S,2R,3R,5R)-3-[(Z)-2-(4-hydroxy-1-methylcyclohexyl)ethenyl]-5-(5-methylhexyl)cyclopentane-1,2-diol |
| SMILES | CC(C)CCCC[C@@H]1C[C@H](/C=C\C2(C)CCC(O)CC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H38O3/c1-15(2)6-4-5-7-16-14-17(20(24)19(16)23)8-11-21(3)12-9-18(22)10-13-21/h8,11,15-20,22-24H,4-7,9-10,12-14H2,1-3H3/b11-8-/t16-,17+,18?,19+,20-,21?/m1/s1 |
| InChIKey | FMIPVOXDRVXYDX-PAGYKJKZSA-N |
| XLogP | 4.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|