C26H44O3 — CID 143014771
(3S,3aR,5bR,8S,10R)-8,9a-dihydroxy-3a,5b-dimethyl-3-(5-methylhexyl)-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carbaldehyde (PubChem CID 143014771) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is (3S,3aR,5bR,8S,10R)-8,9a-dihydroxy-3a,5b-dimethyl-3-(5-methylhexyl)-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carbaldehyde.
| Compound Name | (3S,3aR,5bR,8S,10R)-8,9a-dihydroxy-3a,5b-dimethyl-3-(5-methylhexyl)-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carbaldehyde |
|---|---|
| PubChem CID | 143014771 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | (3S,3aR,5bR,8S,10R)-8,9a-dihydroxy-3a,5b-dimethyl-3-(5-methylhexyl)-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carbaldehyde |
| SMILES | CC(C)CCCC[C@H]1CCC2C3C(C=O)C4(O)C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H44O3/c1-17(2)7-5-6-8-18-9-10-20-23-21(12-13-24(18,20)3)25(4)14-11-19(28)15-26(25,29)22(23)16-27/h16-23,28-29H,5-15H2,1-4H3/t18-,19-,20?,21?,22?,23?,24+,25+,26?/m0/s1 |
| InChIKey | ZJCWWNRHWJEIIX-KUMCUTTGSA-N |
| XLogP | 5.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|