C16H11Cl2NO4 — CID 10428039
methyl 2-[2-(3,5-dichloroanilino)-2-oxoacetyl]benzoate (PubChem CID 10428039) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is methyl 2-[2-(3,5-dichloroanilino)-2-oxoacetyl]benzoate.
| Compound Name | methyl 2-[2-(3,5-dichloroanilino)-2-oxoacetyl]benzoate |
|---|---|
| PubChem CID | 10428039 |
| Molecular Formula | C16H11Cl2NO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | methyl 2-[2-(3,5-dichloroanilino)-2-oxoacetyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2NO4/c1-23-16(22)13-5-3-2-4-12(13)14(20)15(21)19-11-7-9(17)6-10(18)8-11/h2-8H,1H3,(H,19,21) |
| InChIKey | JVKBTRHDIKGVDY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|