C17H15ClF2O2S — CID 10428379
benzhydryl 2-chloro-2-(2,2-difluoroethylsulfanyl)acetate (PubChem CID 10428379) has the molecular formula C17H15ClF2O2S and a molecular weight of 356.82 g/mol. Its IUPAC name is benzhydryl 2-chloro-2-(2,2-difluoroethylsulfanyl)acetate.
| Compound Name | benzhydryl 2-chloro-2-(2,2-difluoroethylsulfanyl)acetate |
|---|---|
| PubChem CID | 10428379 |
| Molecular Formula | C17H15ClF2O2S |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | benzhydryl 2-chloro-2-(2,2-difluoroethylsulfanyl)acetate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C(Cl)SCC(F)F |
| InChI | InChI=1S/C17H15ClF2O2S/c18-16(23-11-14(19)20)17(21)22-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-16H,11H2 |
| InChIKey | QXSZCZWCOMKJBN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|