C19H16ClF3O3S — CID 134869597
trifluoromethyl 2-[5-(chloromethyl)-2-phenyl-1,3-oxathiolan-2-yl]-2-phenylacetate (PubChem CID 134869597) has the molecular formula C19H16ClF3O3S and a molecular weight of 416.85 g/mol. Its IUPAC name is trifluoromethyl 2-[5-(chloromethyl)-2-phenyl-1,3-oxathiolan-2-yl]-2-phenylacetate.
| Compound Name | trifluoromethyl 2-[5-(chloromethyl)-2-phenyl-1,3-oxathiolan-2-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 134869597 |
| Molecular Formula | C19H16ClF3O3S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | trifluoromethyl 2-[5-(chloromethyl)-2-phenyl-1,3-oxathiolan-2-yl]-2-phenylacetate |
| SMILES | O=C(OC(F)(F)F)C(c1ccccc1)C1(c2ccccc2)OC(CCl)CS1 |
| InChI | InChI=1S/C19H16ClF3O3S/c20-11-15-12-27-18(25-15,14-9-5-2-6-10-14)16(13-7-3-1-4-8-13)17(24)26-19(21,22)23/h1-10,15-16H,11-12H2 |
| InChIKey | ZYHLYDAGJSISEV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|