C22H22N2O3 — CID 10428730
4-(3,4-dimethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 10428730) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10428730 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(c3ccccc3)C(=O)C3CC=CCC23)cc1OC |
| InChI | InChI=1S/C22H22N2O3/c1-26-19-13-12-15(14-20(19)27-2)21-17-10-6-7-11-18(17)22(25)24(23-21)16-8-4-3-5-9-16/h3-9,12-14,17-18H,10-11H2,1-2H3 |
| InChIKey | SEWBUIWTHYNBNC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|