C18H18N2O3 — CID 11109680
6-(3,4-dimethoxyphenyl)-2-phenyl-4,5-dihydropyridazin-3-one (PubChem CID 11109680) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-2-phenyl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-2-phenyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 11109680 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-2-phenyl-4,5-dihydropyridazin-3-one |
| SMILES | COc1ccc(C2=NN(c3ccccc3)C(=O)CC2)cc1OC |
| InChI | InChI=1S/C18H18N2O3/c1-22-16-10-8-13(12-17(16)23-2)15-9-11-18(21)20(19-15)14-6-4-3-5-7-14/h3-8,10,12H,9,11H2,1-2H3 |
| InChIKey | KOZNRVVBQXILKV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |