C17H15Cl2F3O2 — CID 10429777
8-chloro-8-[2-chloro-5-(trifluoromethyl)phenyl]spiro[4.5]decane-7,9-dione (PubChem CID 10429777) has the molecular formula C17H15Cl2F3O2 and a molecular weight of 379.21 g/mol. Its IUPAC name is 8-chloro-8-[2-chloro-5-(trifluoromethyl)phenyl]spiro[4.5]decane-7,9-dione.
| Compound Name | 8-chloro-8-[2-chloro-5-(trifluoromethyl)phenyl]spiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 10429777 |
| Molecular Formula | C17H15Cl2F3O2 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 8-chloro-8-[2-chloro-5-(trifluoromethyl)phenyl]spiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)C1(Cl)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H15Cl2F3O2/c18-12-4-3-10(17(20,21)22)7-11(12)16(19)13(23)8-15(9-14(16)24)5-1-2-6-15/h3-4,7H,1-2,5-6,8-9H2 |
| InChIKey | FHHCTBADEMEWSQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|