C15H18F3NO2 — CID 106702526
1-[2-amino-5-(trifluoromethyl)phenyl]cycloheptane-1-carboxylic acid (PubChem CID 106702526) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethyl)phenyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[2-amino-5-(trifluoromethyl)phenyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 106702526 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethyl)phenyl]cycloheptane-1-carboxylic acid |
| SMILES | Nc1ccc(C(F)(F)F)cc1C1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C15H18F3NO2/c16-15(17,18)10-5-6-12(19)11(9-10)14(13(20)21)7-3-1-2-4-8-14/h5-6,9H,1-4,7-8,19H2,(H,20,21) |
| InChIKey | FPDICHZWSZQIQU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|