C13H14BrF2NO2 — CID 106702453
1-(2-amino-5-bromophenyl)-4,4-difluorocyclohexane-1-carboxylic acid (PubChem CID 106702453) has the molecular formula C13H14BrF2NO2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenyl)-4,4-difluorocyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-amino-5-bromophenyl)-4,4-difluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106702453 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-(2-amino-5-bromophenyl)-4,4-difluorocyclohexane-1-carboxylic acid |
| SMILES | Nc1ccc(Br)cc1C1(C(=O)O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H14BrF2NO2/c14-8-1-2-10(17)9(7-8)12(11(18)19)3-5-13(15,16)6-4-12/h1-2,7H,3-6,17H2,(H,18,19) |
| InChIKey | VSCWMKONTAVBSY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|