About pteridine
pteridine (PubChem CID 1043) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is pteridine.
Molecular Properties
| Compound Name | pteridine |
| PubChem CID | 1043 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | pteridine |
| SMILES | c1cnc2ncncc2n1 |
| InChI | InChI=1S/C6H4N4/c1-2-9-6-5(8-1)3-7-4-10-6/h1-4H |
| InChIKey | CPNGPNLZQNNVQM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pteridine?
The IUPAC name of pteridine (CID 1043) is pteridine.
What is the SMILES notation for pteridine?
The canonical SMILES for pteridine is c1cnc2ncncc2n1.
What is the InChIKey of pteridine?
The InChIKey is CPNGPNLZQNNVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4/c1-2-9-6-5(8-1)3-7-4-10-6/h1-4H.
What are the key properties of pteridine?
pteridine has a molecular weight of 132.13 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pteridine is sourced from PubChem (CID 1043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).