C16H22BrN3O3 — CID 10430084
N-[8-bromo-2-(2-methylbutyl)-6-nitro-3,4-dihydro-1H-isoquinolin-5-yl]acetamide (PubChem CID 10430084) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is N-[8-bromo-2-(2-methylbutyl)-6-nitro-3,4-dihydro-1H-isoquinolin-5-yl]acetamide.
| Compound Name | N-[8-bromo-2-(2-methylbutyl)-6-nitro-3,4-dihydro-1H-isoquinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 10430084 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[8-bromo-2-(2-methylbutyl)-6-nitro-3,4-dihydro-1H-isoquinolin-5-yl]acetamide |
| SMILES | CCC(C)CN1CCc2c(c(Br)cc([N+](=O)[O-])c2NC(C)=O)C1 |
| InChI | InChI=1S/C16H22BrN3O3/c1-4-10(2)8-19-6-5-12-13(9-19)14(17)7-15(20(22)23)16(12)18-11(3)21/h7,10H,4-6,8-9H2,1-3H3,(H,18,21) |
| InChIKey | HWIKGVCBJACYFA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|