C11H14BrClN2O2 — CID 67802248
4-bromo-N-methyl-2-nitro-5,6,7,8-tetrahydronaphthalen-1-amine;hydrochloride (PubChem CID 67802248) has the molecular formula C11H14BrClN2O2 and a molecular weight of 321.60 g/mol. Its IUPAC name is 4-bromo-N-methyl-2-nitro-5,6,7,8-tetrahydronaphthalen-1-amine;hydrochloride.
| Compound Name | 4-bromo-N-methyl-2-nitro-5,6,7,8-tetrahydronaphthalen-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67802248 |
| Molecular Formula | C11H14BrClN2O2 |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 4-bromo-N-methyl-2-nitro-5,6,7,8-tetrahydronaphthalen-1-amine;hydrochloride |
| SMILES | CNc1c([N+](=O)[O-])cc(Br)c2c1CCCC2.Cl |
| InChI | InChI=1S/C11H13BrN2O2.ClH/c1-13-11-8-5-3-2-4-7(8)9(12)6-10(11)14(15)16;/h6,13H,2-5H2,1H3;1H |
| InChIKey | QHRDROWLOHKKPT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|