C9H9BrN2O3 — CID 22605917
2-bromo-4-nitro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium (PubChem CID 22605917) has the molecular formula C9H9BrN2O3 and a molecular weight of 273.09 g/mol. Its IUPAC name is 2-bromo-4-nitro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium.
| Compound Name | 2-bromo-4-nitro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 22605917 |
| Molecular Formula | C9H9BrN2O3 |
| Molecular Weight | 273.09 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2-bromo-4-nitro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium |
| SMILES | O=[N+]([O-])c1cc(Br)[n+]([O-])c2c1CCCC2 |
| InChI | InChI=1S/C9H9BrN2O3/c10-9-5-8(12(14)15)6-3-1-2-4-7(6)11(9)13/h5H,1-4H2 |
| InChIKey | XICXWCILIDFKQV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.09 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|