C9H8INO3 — CID 23031109
5-iodo-7-nitro-2,3-dihydro-1H-inden-4-ol (PubChem CID 23031109) has the molecular formula C9H8INO3 and a molecular weight of 305.07 g/mol. Its IUPAC name is 5-iodo-7-nitro-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 5-iodo-7-nitro-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 23031109 |
| Molecular Formula | C9H8INO3 |
| Molecular Weight | 305.07 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 5-iodo-7-nitro-2,3-dihydro-1H-inden-4-ol |
| SMILES | O=[N+]([O-])c1cc(I)c(O)c2c1CCC2 |
| InChI | InChI=1S/C9H8INO3/c10-7-4-8(11(13)14)5-2-1-3-6(5)9(7)12/h4,12H,1-3H2 |
| InChIKey | QXXNELKHKCEIPC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.07 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|