C16H16N4O7 — CID 71401087
4-methyl-5,6,7,8-tetrahydroquinoline;2,4,6-trinitrophenol (PubChem CID 71401087) has the molecular formula C16H16N4O7 and a molecular weight of 376.33 g/mol. Its IUPAC name is 4-methyl-5,6,7,8-tetrahydroquinoline;2,4,6-trinitrophenol.
| Compound Name | 4-methyl-5,6,7,8-tetrahydroquinoline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71401087 |
| Molecular Formula | C16H16N4O7 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-methyl-5,6,7,8-tetrahydroquinoline;2,4,6-trinitrophenol |
| SMILES | Cc1ccnc2c1CCCC2.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13N.C6H3N3O7/c1-8-6-7-11-10-5-3-2-4-9(8)10;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h6-7H,2-5H2,1H3;1-2,10H |
| InChIKey | VKEIGUDBMSLDSE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|