C25H24N2O6 — CID 1043024
1-[(1R)-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenoxyethanone (PubChem CID 1043024) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-[(1R)-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenoxyethanone.
| Compound Name | 1-[(1R)-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 1043024 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[(1R)-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenoxyethanone |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1cccc([N+](=O)[O-])c1)N(C(=O)COc1ccccc1)CC2 |
| InChI | InChI=1S/C25H24N2O6/c1-31-22-14-17-11-12-26(24(28)16-33-20-9-4-3-5-10-20)25(21(17)15-23(22)32-2)18-7-6-8-19(13-18)27(29)30/h3-10,13-15,25H,11-12,16H2,1-2H3/t25-/m1/s1 |
| InChIKey | XJNALYCRJLKSSS-RUZDIDTESA-N |
| XLogP | 4.17 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|