C28H31N3O7 — CID 122202725
(1S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 122202725) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is (1S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (1S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 122202725 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (1S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-1-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)N2CCc3cc(OC)c(OC)cc3[C@@H]2c2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C28H31N3O7/c1-35-23-9-8-18(14-24(23)36-2)10-12-29-28(32)30-13-11-19-16-25(37-3)26(38-4)17-22(19)27(30)20-6-5-7-21(15-20)31(33)34/h5-9,14-17,27H,10-13H2,1-4H3,(H,29,32)/t27-/m0/s1 |
| InChIKey | XGISNJTVAIKNEQ-MHZLTWQESA-N |
| XLogP | 4.53 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|