C21H22N2O7 — CID 8501754
methyl 2-[(1S)-6,7-dimethoxy-2-(3-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 8501754) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is methyl 2-[(1S)-6,7-dimethoxy-2-(3-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | methyl 2-[(1S)-6,7-dimethoxy-2-(3-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 8501754 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl 2-[(1S)-6,7-dimethoxy-2-(3-nitrobenzoyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | COC(=O)C[C@H]1c2cc(OC)c(OC)cc2CCN1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22N2O7/c1-28-18-10-13-7-8-22(21(25)14-5-4-6-15(9-14)23(26)27)17(12-20(24)30-3)16(13)11-19(18)29-2/h4-6,9-11,17H,7-8,12H2,1-3H3/t17-/m0/s1 |
| InChIKey | AIJVRFLDDKFCAP-KRWDZBQOSA-N |
| XLogP | 2.91 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|