C21H38O5Si — CID 10431000
methyl 2-[(2S,3aR,5R,6aR)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]acetate (PubChem CID 10431000) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is methyl 2-[(2S,3aR,5R,6aR)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3aR,5R,6aR)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]acetate |
|---|---|
| PubChem CID | 10431000 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | methyl 2-[(2S,3aR,5R,6aR)-5-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]acetate |
| SMILES | CC/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@H]2O[C@H](CC(=O)OC)C[C@H]2O1 |
| InChI | InChI=1S/C21H38O5Si/c1-8-9-10-11-16(26-27(6,7)21(2,3)4)18-14-19-17(25-18)12-15(24-19)13-20(22)23-5/h9-10,15-19H,8,11-14H2,1-7H3/b10-9+/t15-,16-,17+,18+,19+/m0/s1 |
| InChIKey | KFENARDMGJVZMK-ICOWJTGXSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|