C29H52O5Si — CID 11214370
5-[(2S,5S)-5-[(2S,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxyundec-4-enyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one (PubChem CID 11214370) has the molecular formula C29H52O5Si and a molecular weight of 508.82 g/mol. Its IUPAC name is 5-[(2S,5S)-5-[(2S,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxyundec-4-enyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one.
| Compound Name | 5-[(2S,5S)-5-[(2S,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxyundec-4-enyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 11214370 |
| Molecular Formula | C29H52O5Si |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | 5-[(2S,5S)-5-[(2S,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxyundec-4-enyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one |
| SMILES | CCCCCC/C=C/CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@@H]([C@@H]2CC[C@@H](C3CCC(=O)O3)O2)O1 |
| InChI | InChI=1S/C29H52O5Si/c1-7-8-9-10-11-12-13-14-15-27(34-35(5,6)29(2,3)4)26-19-18-23(32-26)22-16-17-24(31-22)25-20-21-28(30)33-25/h12-13,22-27H,7-11,14-21H2,1-6H3/b13-12+/t22-,23-,24-,25?,26+,27+/m0/s1 |
| InChIKey | SXRJFMKQTRWMCV-TXESIXQISA-N |
| XLogP | 7.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|