C22H42O4Si — CID 5366685
methyl (Z)-12-(5-ethyloxolan-2-yl)-12-trimethylsilyloxydodec-9-enoate (PubChem CID 5366685) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is methyl (Z)-12-(5-ethyloxolan-2-yl)-12-trimethylsilyloxydodec-9-enoate.
| Compound Name | methyl (Z)-12-(5-ethyloxolan-2-yl)-12-trimethylsilyloxydodec-9-enoate |
|---|---|
| PubChem CID | 5366685 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | methyl (Z)-12-(5-ethyloxolan-2-yl)-12-trimethylsilyloxydodec-9-enoate |
| SMILES | CCC1CCC(C(C/C=C\CCCCCCCC(=O)OC)O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C22H42O4Si/c1-6-19-17-18-20(25-19)21(26-27(3,4)5)15-13-11-9-7-8-10-12-14-16-22(23)24-2/h11,13,19-21H,6-10,12,14-18H2,1-5H3/b13-11- |
| InChIKey | RJJPPIHXZVQKPE-QBFSEMIESA-N |
| XLogP | 6.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|