C23H38O5 — CID 11858543
[(E,1S)-1-[(2S,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]tridec-4-enyl] acetate (PubChem CID 11858543) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is [(E,1S)-1-[(2S,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]tridec-4-enyl] acetate.
| Compound Name | [(E,1S)-1-[(2S,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]tridec-4-enyl] acetate |
|---|---|
| PubChem CID | 11858543 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [(E,1S)-1-[(2S,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]tridec-4-enyl] acetate |
| SMILES | CCCCCCCC/C=C/CC[C@H](OC(C)=O)[C@@H]1CC[C@H]([C@H]2CCC(=O)O2)O1 |
| InChI | InChI=1S/C23H38O5/c1-3-4-5-6-7-8-9-10-11-12-13-19(26-18(2)24)20-14-15-21(27-20)22-16-17-23(25)28-22/h10-11,19-22H,3-9,12-17H2,1-2H3/b11-10+/t19-,20-,21+,22+/m0/s1 |
| InChIKey | OVSSDNNTQGAPNA-XRXMAVHFSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|