C20H25ClN2O4S — CID 10432510
dibutyl(phenothiazin-3-ylidene)azanium perchlorate (PubChem CID 10432510) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is dibutyl(phenothiazin-3-ylidene)azanium perchlorate.
| Compound Name | dibutyl(phenothiazin-3-ylidene)azanium perchlorate |
|---|---|
| PubChem CID | 10432510 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | dibutyl(phenothiazin-3-ylidene)azanium perchlorate |
| SMILES | CCCC[N+](CCCC)=c1ccc2nc3ccccc3sc-2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H25N2S.ClHO4/c1-3-5-13-22(14-6-4-2)16-11-12-18-20(15-16)23-19-10-8-7-9-17(19)21-18;2-1(3,4)5/h7-12,15H,3-6,13-14H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XEIQWJVASSRRTK-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 108.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|