About hexane;phenothiazin-3-one
hexane;phenothiazin-3-one (PubChem CID 170982113) has the molecular formula C18H21NOS
and a molecular weight of 299.44 g/mol. Its IUPAC name is hexane;phenothiazin-3-one.
Molecular Properties
| Compound Name | hexane;phenothiazin-3-one |
| PubChem CID | 170982113 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | hexane;phenothiazin-3-one |
| SMILES | CCCCCC.O=c1ccc2nc3ccccc3sc-2c1 |
| InChI | InChI=1S/C12H7NOS.C6H14/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13-10;1-3-5-6-4-2/h1-7H;3-6H2,1-2H3 |
| InChIKey | PRLNAJTXNBOEPC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze hexane;phenothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;phenothiazin-3-one?
The IUPAC name of hexane;phenothiazin-3-one (CID 170982113) is hexane;phenothiazin-3-one.
What is the SMILES notation for hexane;phenothiazin-3-one?
The canonical SMILES for hexane;phenothiazin-3-one is CCCCCC.O=c1ccc2nc3ccccc3sc-2c1.
What is the InChIKey of hexane;phenothiazin-3-one?
The InChIKey is PRLNAJTXNBOEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NOS.C6H14/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13-10;1-3-5-6-4-2/h1-7H;3-6H2,1-2H3.
What are the key properties of hexane;phenothiazin-3-one?
hexane;phenothiazin-3-one has a molecular weight of 299.44 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;phenothiazin-3-one is sourced from PubChem (CID 170982113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).