C21H25N3OS — CID 171553806
7-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenothiazin-3-one;propane (PubChem CID 171553806) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 7-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenothiazin-3-one;propane.
| Compound Name | 7-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenothiazin-3-one;propane |
|---|---|
| PubChem CID | 171553806 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 7-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenothiazin-3-one;propane |
| SMILES | CCC.O=c1ccc2nc3ccc(N4CC5CCC(C4)N5)cc3sc-2c1 |
| InChI | InChI=1S/C18H17N3OS.C3H8/c22-14-4-6-16-18(8-14)23-17-7-13(3-5-15(17)20-16)21-9-11-1-2-12(10-21)19-11;1-3-2/h3-8,11-12,19H,1-2,9-10H2;3H2,1-2H3 |
| InChIKey | JVWZQCWTQSSUBD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|