C17H24N2Si — CID 159647124
2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethynyl-trimethylsilane (PubChem CID 159647124) has the molecular formula C17H24N2Si and a molecular weight of 284.48 g/mol. Its IUPAC name is 2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 159647124 |
| Molecular Formula | C17H24N2Si |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc(N2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C17H24N2Si/c1-20(2,3)11-10-14-4-8-17(9-5-14)19-12-15-6-7-16(13-19)18-15/h4-5,8-9,15-16,18H,6-7,12-13H2,1-3H3 |
| InChIKey | VNKMYBLNPSIIRD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|