C21H21N3OS — CID 170982120
7-[(1S,5R)-8-cyclopropyl-3,8-diazabicyclo[3.2.1]octan-3-yl]phenothiazin-3-one (PubChem CID 170982120) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 7-[(1S,5R)-8-cyclopropyl-3,8-diazabicyclo[3.2.1]octan-3-yl]phenothiazin-3-one.
| Compound Name | 7-[(1S,5R)-8-cyclopropyl-3,8-diazabicyclo[3.2.1]octan-3-yl]phenothiazin-3-one |
|---|---|
| PubChem CID | 170982120 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 7-[(1S,5R)-8-cyclopropyl-3,8-diazabicyclo[3.2.1]octan-3-yl]phenothiazin-3-one |
| SMILES | O=c1ccc2nc3ccc(N4C[C@H]5CC[C@@H](C4)N5C4CC4)cc3sc-2c1 |
| InChI | InChI=1S/C21H21N3OS/c25-17-6-8-19-21(10-17)26-20-9-14(5-7-18(20)22-19)23-11-15-3-4-16(12-23)24(15)13-1-2-13/h5-10,13,15-16H,1-4,11-12H2/t15-,16+ |
| InChIKey | WZXOJMQGDAMGSG-IYBDPMFKSA-N |
| XLogP | 3.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|