C24H29N3OS — CID 170982103
7-(3-propan-2-yl-3,9-diazaspiro[5.5]undecan-9-yl)phenothiazin-3-one (PubChem CID 170982103) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 7-(3-propan-2-yl-3,9-diazaspiro[5.5]undecan-9-yl)phenothiazin-3-one.
| Compound Name | 7-(3-propan-2-yl-3,9-diazaspiro[5.5]undecan-9-yl)phenothiazin-3-one |
|---|---|
| PubChem CID | 170982103 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 7-(3-propan-2-yl-3,9-diazaspiro[5.5]undecan-9-yl)phenothiazin-3-one |
| SMILES | CC(C)N1CCC2(CCN(c3ccc4nc5ccc(=O)cc-5sc4c3)CC2)CC1 |
| InChI | InChI=1S/C24H29N3OS/c1-17(2)26-11-7-24(8-12-26)9-13-27(14-10-24)18-3-5-20-22(15-18)29-23-16-19(28)4-6-21(23)25-20/h3-6,15-17H,7-14H2,1-2H3 |
| InChIKey | FVNZYMRSAJUXEM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|