C24H34ClN3O5 — CID 11554773
dibutyl-[7-(diethylamino)phenoxazin-3-ylidene]azanium perchlorate (PubChem CID 11554773) has the molecular formula C24H34ClN3O5 and a molecular weight of 480.01 g/mol. Its IUPAC name is dibutyl-[7-(diethylamino)phenoxazin-3-ylidene]azanium perchlorate.
| Compound Name | dibutyl-[7-(diethylamino)phenoxazin-3-ylidene]azanium perchlorate |
|---|---|
| PubChem CID | 11554773 |
| Molecular Formula | C24H34ClN3O5 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | dibutyl-[7-(diethylamino)phenoxazin-3-ylidene]azanium perchlorate |
| SMILES | CCCC[N+](CCCC)=c1ccc2nc3ccc(N(CC)CC)cc3oc-2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H34N3O.ClHO4/c1-5-9-15-27(16-10-6-2)20-12-14-22-24(18-20)28-23-17-19(26(7-3)8-4)11-13-21(23)25-22;2-1(3,4)5/h11-14,17-18H,5-10,15-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | JHDZKNLBCHHSGM-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 124.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|