C21H27ClN3O6S+ — CID 174190320
2-carboxyethyl-[7-[ethyl(3-sulfopropyl)amino]phenoxazin-3-ylidene]-methylazanium;hydrochloride (PubChem CID 174190320) has the molecular formula C21H27ClN3O6S+ and a molecular weight of 484.98 g/mol. Its IUPAC name is 2-carboxyethyl-[7-[ethyl(3-sulfopropyl)amino]phenoxazin-3-ylidene]-methylazanium;hydrochloride.
| Compound Name | 2-carboxyethyl-[7-[ethyl(3-sulfopropyl)amino]phenoxazin-3-ylidene]-methylazanium;hydrochloride |
|---|---|
| PubChem CID | 174190320 |
| Molecular Formula | C21H27ClN3O6S+ |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-carboxyethyl-[7-[ethyl(3-sulfopropyl)amino]phenoxazin-3-ylidene]-methylazanium;hydrochloride |
| SMILES | CCN(CCCS(=O)(=O)O)c1ccc2nc3cc/c(=[N+](/C)CCC(=O)O)cc-3oc2c1.Cl |
| InChI | InChI=1S/C21H25N3O6S.ClH/c1-3-24(10-4-12-31(27,28)29)16-6-8-18-20(14-16)30-19-13-15(5-7-17(19)22-18)23(2)11-9-21(25)26;/h5-8,13-14H,3-4,9-12H2,1-2H3,(H-,25,26,27,28,29);1H/p+1 |
| InChIKey | XZGARGFAUIOOKB-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|