C21H28ClN3O5 — CID 158420932
[7-(diethylamino)phenoxazin-3-ylidene]-ethyl-propylazanium perchlorate (PubChem CID 158420932) has the molecular formula C21H28ClN3O5 and a molecular weight of 437.92 g/mol. Its IUPAC name is [7-(diethylamino)phenoxazin-3-ylidene]-ethyl-propylazanium perchlorate.
| Compound Name | [7-(diethylamino)phenoxazin-3-ylidene]-ethyl-propylazanium perchlorate |
|---|---|
| PubChem CID | 158420932 |
| Molecular Formula | C21H28ClN3O5 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [7-(diethylamino)phenoxazin-3-ylidene]-ethyl-propylazanium perchlorate |
| SMILES | CCC/[N+](CC)=c1/ccc2nc3ccc(N(CC)CC)cc3oc-2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H28N3O.ClHO4/c1-5-13-24(8-4)17-10-12-19-21(15-17)25-20-14-16(23(6-2)7-3)9-11-18(20)22-19;2-1(3,4)5/h9-12,14-15H,5-8,13H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HAMFDURPWWPRNW-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 124.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|