C20H26N3O3+ — CID 59653482
[7-(diethylamino)phenoxazin-3-ylidene]-bis(2-hydroxyethyl)azanium (PubChem CID 59653482) has the molecular formula C20H26N3O3+ and a molecular weight of 356.45 g/mol. Its IUPAC name is [7-(diethylamino)phenoxazin-3-ylidene]-bis(2-hydroxyethyl)azanium.
| Compound Name | [7-(diethylamino)phenoxazin-3-ylidene]-bis(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 59653482 |
| Molecular Formula | C20H26N3O3+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [7-(diethylamino)phenoxazin-3-ylidene]-bis(2-hydroxyethyl)azanium |
| SMILES | CCN(CC)c1ccc2nc3ccc(=[N+](CCO)CCO)cc-3oc2c1 |
| InChI | InChI=1S/C20H26N3O3/c1-3-22(4-2)15-5-7-17-19(13-15)26-20-14-16(6-8-18(20)21-17)23(9-11-24)10-12-25/h5-8,13-14,24-25H,3-4,9-12H2,1-2H3/q+1 |
| InChIKey | NBCXVMRWHVQYKL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|