C22H21N3O — CID 22950317
N,N-diethyl-7-phenyliminophenoxazin-3-amine (PubChem CID 22950317) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is N,N-diethyl-7-phenyliminophenoxazin-3-amine.
| Compound Name | N,N-diethyl-7-phenyliminophenoxazin-3-amine |
|---|---|
| PubChem CID | 22950317 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N,N-diethyl-7-phenyliminophenoxazin-3-amine |
| SMILES | CCN(CC)c1ccc2nc3cc/c(=N\c4ccccc4)cc-3oc2c1 |
| InChI | InChI=1S/C22H21N3O/c1-3-25(4-2)18-11-13-20-22(15-18)26-21-14-17(10-12-19(21)24-20)23-16-8-6-5-7-9-16/h5-15H,3-4H2,1-2H3/b23-17+ |
| InChIKey | CYKNJGHPRJNRMV-HAVVHWLPSA-N |
| XLogP | 5.01 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|